| Melting point |
169-173 °C (dec.) (lit.) |
| Boiling point |
334.28°C (rough estimate) |
| Density |
1.3075 (rough estimate) |
| refractive index |
1.5270 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Acetontrile (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form |
Crystalline Powder |
| pka |
2.35±0.10(Predicted) |
| color |
White, beige, or gray to brown |
| Water Solubility |
Soluble in Methanol and Water |
| BRN |
782814 |
| Stability |
May be Sensitive To Air Oxidation, Light Sensitive |
| InChI |
InChI=1S/C9H11NO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey |
HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC(OC)=C(OC)C=C1N |
| CAS DataBase Reference |
5653-40-7(CAS DataBase Reference) |
