2-Amino-3,4,5-trimethoxybenzoic acid
- Product Name2-Amino-3,4,5-trimethoxybenzoic acid
- CAS61948-85-4
- MFC10H13NO5
- MW227.21
- EINECS263-344-2
- MOL File61948-85-4.mol
Chemical Properties
| Melting point | 137-141 °C (lit.) |
| Boiling point | 371.0±42.0 °C(Predicted) |
| Density | 1.289±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 2.23±0.10(Predicted) |
| color | White to Light yellow |
| λmax | 339nm(EtOH)(lit.) |
| BRN | 3353856 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H13NO5/c1-14-6-4-5(10(12)13)7(11)9(16-3)8(6)15-2/h4H,11H2,1-3H3,(H,12,13) |
| InChIKey | JSHSRQCOCMIIPA-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)=O)c(N)c(OC)c1OC |
| CAS DataBase Reference | 61948-85-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 28-36/37 |
| WGK Germany | 3 |
| HS Code | 2922.49.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |