Nitroxinil
- Product NameNitroxinil
- CAS1689-89-0
- MFC7H3IN2O3
- MW290.01
- EINECS216-884-8
- MOL File1689-89-0.mol
Chemical Properties
| Melting point | 137-138° |
| Boiling point | 280.1±40.0 °C(Predicted) |
| Density | 2.1385 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.00±0.38(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C7H3IN2O3/c8-5-1-4(3-9)2-6(7(5)11)10(12)13/h1-2,11H |
| InChIKey | SGKGVABHDAQAJO-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=C(O)C(I)=C1 |
| CAS DataBase Reference | 1689-89-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Nitroxinil(1689-89-0) |
| EPA Substance Registry System | Nitroxynil (1689-89-0) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36/37/38-43 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DI4600000 |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity | mammal (species unspecified),LDLo,oral,125mg/kg (125mg/kg),Fortschritte der Arzneimittelforschung. Progress in Drug Research. Vol. 17, Pg. 108, 1973. |
