beta-Pinene
- Product Namebeta-Pinene
- CAS127-91-3
- MFC10H16
- MW136.23
- EINECS204-872-5
- MOL File127-91-3.mol
Chemical Properties
| Melting point | -61°C |
| Boiling point | 167°C |
| Density | 0.859 |
| refractive index | 1.4782 |
| FEMA | 2903 | BETA-PINENE |
| Flash point | 43°C |
| storage temp. | 2-8°C |
| Odor | at 10.00 % in dipropylene glycol. dry woody resinous pine hay green eucalyptus camphoreous |
| Odor Type | herbal |
| Water Solubility | 12mg/L(25 ºC) |
| Merck | 7446 |
| JECFA Number | 1330 |
| Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3 |
| InChIKey | WTARULDDTDQWMU-UHFFFAOYSA-N |
| SMILES | [C@@H]21C(C(C2)C(=C)CC1)(C)C |
Safety Information
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | 2368 |
| WGK Germany | WGK 3 |
| RTECS | DT5077000 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 127-91-3(Hazardous Substances Data) |