Madecassic acid
- Product NameMadecassic acid
- CAS18449-41-7
- MFC30H48O6
- MW504.71
- EINECS240-851-7
- MOL File18449-41-7.mol
Chemical Properties
| Melting point | 270°C (dec.) |
| Boiling point | 641.7±55.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated) |
| pka | 4.63±0.70(Predicted) |
| form | Solid |
| color | White to Pale Red |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | PRAUVHZJPXOEIF-MRQYELSVNA-N |
| SMILES | O[C@H]1[C@@H]2[C@@]([C@@H]3[C@]([C@@]4(CC[C@@]5([C@@H]([C@H]([C@@H](CC5)C)C)C4=CC3)C(=O)O)C)(C1)C)(C[C@H]([C@@H]([C@]2(CO)C)O)O)C |
| LogP | 4.321 (est) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
