Quinuclidine hydrochloride
- Product NameQuinuclidine hydrochloride
- CAS39896-06-5
- MFC7H14ClN
- MW147.65
- EINECS254-682-1
- MOL File39896-06-5.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| solubility | H2O: 0.1 g/mL, clear |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,8081 |
| BRN | 3675063 |
| InChI | InChI=1S/C7H13N.ClH/c1-4-8-5-2-7(1)3-6-8;/h7H,1-6H2;1H |
| InChIKey | BZLBBZLOMXKMTA-UHFFFAOYSA-N |
| SMILES | C12CCN(CC1)CC2.Cl |
Safety Information
| Safety Statements | 22-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2933.39.6190 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |