Quinine dihydrochloride
- Product NameQuinine dihydrochloride
- CAS60-93-5
- MFC20H25ClN2O2
- MW360.88
- EINECS200-493-4
- MOL File60-93-5.mol
Chemical Properties
| Melting point | 238-2400C |
| Stability | Stable, but may be light sensitive. Efflorescent. Incompatible with strong oxidizing agents. |
| InChIKey | LBSFSRMTJJPTCW-QJLYHTAINA-N |
| SMILES | [C@H]([C@]1([H])C[C@@H]2CC[N@]1C[C@@H]2C=C)(C1=CC=NC2=CC=C(OC)C=C12)O.Cl |&1:0,1,4,7,9,r| |
| LogP | 3.440 (est) |
| CAS DataBase Reference | 60-93-5(CAS DataBase Reference) |
| EPA Substance Registry System | Cinchonan-9-ol, 6'-methoxy-, dihydrochloride, (8.alpha.,9R)- (60-93-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1544 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29392000 |
