| Melting point |
>187oC (dec.) |
| Boiling point |
590.1±50.0 °C(Predicted) |
| Density |
1.188±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
DMSO: soluble10mg/mL, clear |
| pka |
4.71±0.40(Predicted) |
| form |
powder |
| color |
white to light brown |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 1 month. |
| InChI |
1S/C21H23N3O2/c1-24(2)12-4-11-23-21(26)16-8-6-15(7-9-16)18-13-17-5-3-10-22-20(17)19(25)14-18/h3,5-10,13-14,25H,4,11-12H2,1-2H3,(H,23,26) |
| InChIKey |
QDBVSOZTVKXUES-UHFFFAOYSA-N |
| SMILES |
CN(C)CCCNC(C1=CC=C(C2=CC(O)=C(N=CC=C3)C3=C2)C=C1)=O |
