Iodonitrotetrazolium chloride
- Product NameIodonitrotetrazolium chloride
- CAS146-68-9
- MFC19H13ClIN5O2
- MW505.7
- EINECS205-676-2
- MOL File146-68-9.mol
Chemical Properties
| Melting point | 240 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | methanol: water (1:1): 50 mg/mL hot, very faintly turbid, very deep yellow |
| form | Powder, Crystals and/or Chunks |
| color | White to off-white |
| Appearance | Yellow powder |
| Water Solubility | soluble |
| Sensitive | Light Sensitive |
| λmax | 248nm |
| BRN | 4093224 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Bacterial vaginosis diagnosis assay; dehydrogenase enzyme assay; diagnostic assay; food and beverage analytes assays; microbial growth assay; detecting bacteria,yeast,fungi,gamma-hydroxybutyric acid (GHB),microbial growth; measuring niacin,bacterial respiratory activity,superoxide dismutase;treating cancer |
| InChI | InChI=1S/C19H13IN5O2.ClH/c20-15-6-8-16(9-7-15)23-21-19(14-4-2-1-3-5-14)22-24(23)17-10-12-18(13-11-17)25(26)27;/h1-13H;1H/q+1;/p-1 |
| InChIKey | JORABGDXCIBAFL-UHFFFAOYSA-M |
| SMILES | [N+]1(=NC(C2C=CC=CC=2)=NN1C1C=CC(I)=CC=1)C1=CC=C([N+]([O-])=O)C=C1.[Cl-] |
| CAS DataBase Reference | 146-68-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Tetrazolium, 2-(4-iodophenyl)-3-(4-nitrophenyl)-5-phenyl-, chloride (146-68-9) |
Safety Information
| Hazard Codes | Xn,F,Xi |
| Risk Statements | 20/21/22-68/20/21/22-36/37/38-11 |
| Safety Statements | 36/37-36/37/39-26-22-16 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 STOT SE 2 STOT SE 3 |
