| Melting point |
204 °C (dec.)(lit.) |
| Boiling point |
728.8±60.0 °C(Predicted) |
| Density |
2.668±0.06 g/cm3(Predicted) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Soluble in water, ethanol, methanol, acetone, acetic acid |
| form |
Powder |
| pka |
3.69(at 25℃) |
| color |
Beige |
| PH Range |
Yellow (3.0) to blue (4.6) |
| Water Solubility |
soluble |
| λmax |
610nm, 388nm |
| ε(extinction coefficient) |
≥55000 at 606-616nm in ethanol and water |
| BRN |
378438 |
| Major Application |
Semiconductors, thin films, recording materials, chemically amplified resists, photography, lithographic plates, inks, toners, detergents, hair dyes, diapers, detecting proteins, contact lens, urine analysis test strips, distinguishing between allergies and infections |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C19H6Br8O5S/c20-7-1-5(2-8(21)16(7)28)19(6-3-9(22)17(29)10(23)4-6)11-12(24)13(25)14(26)15(27)18(11)33(30,31)32-19/h1-4,28-29H |
| InChIKey |
QPMIVFWZGPTDPN-UHFFFAOYSA-N |
| SMILES |
Oc1c(Br)cc(cc1Br)C2(OS(=O)(=O)c3c(Br)c(Br)c(Br)c(Br)c23)c4cc(Br)c(O)c(Br)c4 |
| CAS DataBase Reference |
4430-25-5 |
| EPA Substance Registry System |
Phenol, 4,4'-(4,5,6,7-tetrabromo-1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2,6-dibromo- (4430-25-5) |
