1-(tert-Butoxycarbonyl)-3-pyrrolidinol
- Product Name1-(tert-Butoxycarbonyl)-3-pyrrolidinol
- CAS103057-44-9
- MFC9H17NO3
- MW187.24
- EINECS600-388-7
- MOL File103057-44-9.mol
Chemical Properties
| Melting point | 62.1-62.2°C |
| Boiling point | 273.3±33.0 °C(Predicted) |
| Density | 1.142±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.74±0.20(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h7,11H,4-6H2,1-3H3 |
| InChIKey | APCBTRDHCDOPNY-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(O)C1 |
| CAS DataBase Reference | 103057-44-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-37-45-36/37 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |