3-Methyl-4-nitroanisole
- Product Name3-Methyl-4-nitroanisole
- CAS5367-32-8
- MFC8H9NO3
- MW167.16
- EINECS226-356-9
- MOL File5367-32-8.mol
Chemical Properties
| Melting point | 48-50 °C (lit.) |
| Boiling point | 135 °C / 0.5mmHg |
| Density | 1.2917 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 2328600 |
| InChI | 1S/C8H9NO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5H,1-2H3 |
| InChIKey | RTZOGYCMIMOVHU-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(C)c1)[N+]([O-])=O |
| CAS DataBase Reference | 5367-32-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 4-methoxy-2-methyl-1-nitro-(5367-32-8) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
