Melting point |
163-166 °C |
Boiling point |
426.76°C (rough estimate) |
Density |
1.2932 (rough estimate) |
refractive index |
1.5460 (estimate) |
storage temp. |
-20°C |
solubility |
Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) |
pka |
9.25±0.10(Predicted) |
form |
Fine Crystalline Powder or Needles |
color |
White |
biological source |
synthetic (organic) |
Water Solubility |
water: 50mg/mL, clear to very slightly hazy, colorless to light yellow |
BRN |
32671 |
InChI |
InChI=1S/C12H16N2O6/c1-12(2)19-8-6(5-15)18-10(9(8)20-12)14-4-3-7(16)13-11(14)17/h3-4,6,8-10,15H,5H2,1-2H3,(H,13,16,17)/t6-,8-,9-,10-/m1/s1 |
InChIKey |
GFDUSNQQMOENLR-PEBGCTIMSA-N |
SMILES |
OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@@H]2OC(O[C@H]12)(C)C |
CAS DataBase Reference |
362-43-6(CAS DataBase Reference) |