4-(2-Chloroacetamido)-2,2,6,6-tetramethylpiperidine 1-oxyl
- Product Name4-(2-Chloroacetamido)-2,2,6,6-tetramethylpiperidine 1-oxyl
- CAS36775-23-2
- MFC11H20ClN2O2
- MW247.74
- EINECS
- MOL File36775-23-2.mol
Chemical Properties
| Melting point | 117 °C |
| Boiling point | 398.3°C at 760mmHg |
| Density | 1.16g/cm3 |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C11H20ClN2O2/c1-10(2)5-8(13-9(15)7-12)6-11(3,4)14(10)16/h8H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | FBSZMWFULOUMCP-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1[O])(C)C)NC(=O)CCl)C |
| EPA Substance Registry System | 1-Piperidinyloxy, 4-[(chloroacetyl)amino]-2,2,6,6-tetramethyl- (36775-23-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.59.9500 |