Leucocrystal Violet
- Product NameLeucocrystal Violet
- CAS603-48-5
- MFC25H31N3
- MW373.53
- EINECS210-043-9
- MOL File603-48-5.mol
Chemical Properties
| Melting point | 175-177 °C(lit.) |
| Boiling point | 492.75°C (rough estimate) |
| Density | 1.1857 (rough estimate) |
| vapor pressure | 0-0Pa at 10-30℃ |
| refractive index | 1.6270 (estimate) |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.93±0.24(Predicted) |
| form | powder |
| color | White to light gray to slightly lavender |
| λmax | 260 nm |
| ε(extinction coefficient) | ≥700 at 257-263nm |
| Henry's Law Constant | 6.4×104 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| Stability | Stable, but light and air sensitive. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C25H31N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18,25H,1-6H3 |
| InChIKey | OAZWDJGLIYNYMU-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 32041990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
