LEUCOMALACHITE GREEN
- Product NameLEUCOMALACHITE GREEN
- CAS129-73-7
- MFC23H26N2
- MW330.47
- EINECS204-961-9
- MOL File129-73-7.mol
Chemical Properties
| Melting point | 100-102 °C |
| Boiling point | 475.4±45.0 °C(Predicted) |
| Density | 1.070±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 5.62±0.24(Predicted) |
| color | White to light brown, light green or light blue |
| Water Solubility | Soluble in water (<0.1 mg/ml), chloroform, benzene, ethyl ether, ethanol and toluene. |
| Sensitive | Air Sensitive |
| λmax | 623 nm |
| BRN | 2140506 |
| Henry's Law Constant | 1.0×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C23H26N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17,23H,1-4H3 |
| InChIKey | WZKXBGJNNCGHIC-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(c2ccccc2)c3ccc(cc3)N(C)C |
| CAS DataBase Reference | 129-73-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 40-50/53-22-36/37/38 |
| Safety Statements | 36/37-61-60-36/37/39-27-26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1203055 |
| TSCA | TSCA listed |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Muta. 2 |
| Hazardous Substances Data | 129-73-7(Hazardous Substances Data) |
