(S)-3-(Boc-amino)-4-phenylbutyric acid
- Product Name(S)-3-(Boc-amino)-4-phenylbutyric acid
- CAS51871-62-6
- MFC15H21NO4
- MW279.33
- EINECS
- MOL File51871-62-6.mol
Chemical Properties
| Melting point | 101-107 °C |
| Boiling point | 444.8±38.0 °C(Predicted) |
| Density | 1.139 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.43±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 19.0±2°, c = 1% in methylene chloride |
| BRN | 3060457 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(10-13(17)18)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | ACKWQHCPHJQANL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccccc1 |
| CAS DataBase Reference | 51871-62-6(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
