(S)-3-(Boc-amino)-4-phenylbutyric acid
- Product Name(S)-3-(Boc-amino)-4-phenylbutyric acid
- CAS51871-62-6
- CBNumberCB7103337
- MFC15H21NO4
- MW279.33
- MDL NumberMFCD01076271
- MOL File51871-62-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 101-107 °C |
| Boiling point | 444.8±38.0 °C(Predicted) |
| Density | 1.139 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.43±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 19.0±2°, c = 1% in methylene chloride |
| BRN | 3060457 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(10-13(17)18)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | ACKWQHCPHJQANL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccccc1 |
| CAS DataBase Reference | 51871-62-6(CAS DataBase Reference) |
| UNSPSC Code | 12352209 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29242990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|
