3-Amino-5-(trifluoromethyl)benzoic acid
- Product Name3-Amino-5-(trifluoromethyl)benzoic acid
- CAS328-68-7
- MFC8H6F3NO2
- MW205.13
- EINECS
- MOL File328-68-7.mol
Chemical Properties
| Melting point | 141-146 °C(lit.) |
| Boiling point | 331.9±42.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.93±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Major Application | peptide synthesis |
| InChI | 1S/C8H6F3NO2/c9-8(10,11)5-1-4(7(13)14)2-6(12)3-5/h1-3H,12H2,(H,13,14) |
| InChIKey | WBTHOSZMTIPJLR-UHFFFAOYSA-N |
| SMILES | Nc1cc(cc(c1)C(F)(F)F)C(O)=O |
| CAS DataBase Reference | 328-68-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DD6205700 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
