Ethyl hydrogen malonate
- Product NameEthyl hydrogen malonate
- CAS1071-46-1
- MFC5H8O4
- MW132.11
- EINECS213-992-7
- MOL File1071-46-1.mol
Chemical Properties
| Melting point | -13°C(lit.) |
| Boiling point | 106.5 °C/3 mmHg (lit.) |
| Density | 1.119 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly) |
| form | Liquid |
| pka | pK1:3.55 (25°C) |
| color | Pale yellow |
| Water Solubility | Miscible with water, chloroform and other solvents. |
| BRN | 1758845 |
| InChI | InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7) |
| InChIKey | HGINADPHJQTSKN-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(O)=O |
| CAS DataBase Reference | 1071-46-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29171900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
