2,5-DICHLORO-4-NITROANILINE
- Product Name2,5-DICHLORO-4-NITROANILINE
- CAS6627-34-5
- MFC6H4Cl2N2O2
- MW207.01
- EINECS229-591-5
- MOL File6627-34-5.mol
Chemical Properties
| Melting point | 154-158 °C (lit.) |
| Boiling point | 360.98°C (rough estimate) |
| Density | 1.6257 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | pK1:-1.74(+1) (25°C) |
| color | Light yellow to Amber to Dark green |
| BRN | 2211952 |
| InChI | 1S/C6H4Cl2N2O2/c7-3-2-6(10(11)12)4(8)1-5(3)9/h1-2H,9H2 |
| InChIKey | JBXZCPXEYAEMJS-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 6627-34-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Dichloro-4-nitroaniline (6627-34-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BX2950000 |
| TSCA | TSCA listed |
| HS Code | 29214200 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
