4,5-Dichloro-2-nitroaniline
- Product Name4,5-Dichloro-2-nitroaniline
- CAS6641-64-1
- MFC6H4Cl2N2O2
- MW207.01
- EINECS229-657-3
- MOL File6641-64-1.mol
Chemical Properties
| Melting point | 177-179 °C (lit.) |
| Boiling point | 347.1±37.0 °C(Predicted) |
| Density | 1.624±0.06 g/cm3(Predicted) |
| vapor pressure | 0.199Pa at 78.175℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -2.24±0.25(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| Water Solubility | 60.3mg/L at 25℃ |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H,9H2 |
| InChIKey | FSGTULQLEVAYRS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C(Cl)C=C1[N+]([O-])=O |
| LogP | 3.31 at 25℃ |
| CAS DataBase Reference | 6641-64-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,5-Dichloro-2-nitroaniline(6641-64-1) |
| EPA Substance Registry System | 4,5-Dichloro-2-nitroaniline (6641-64-1) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-22 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
