2-Bromobenzoyl chloride
- Product Name2-Bromobenzoyl chloride
- CAS7154-66-7
- MFC7H4BrClO
- MW219.46
- EINECS230-507-4
- MOL File7154-66-7.mol
Chemical Properties
| Melting point | 10 °C |
| Boiling point | 245 °C |
| Density | 1.68 |
| refractive index | 1.59 |
| Flash point | > 112 °C |
| storage temp. | 0-6°C |
| solubility | soluble in Chloroform, Methanol |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.680 |
| Sensitive | Moisture Sensitive |
| BRN | 508506 |
| InChI | InChI=1S/C7H4BrClO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H |
| InChIKey | NZCKTGCKFJDGFD-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC=C1Br |
| CAS DataBase Reference | 7154-66-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromobenzoyl chloride(7154-66-7) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6635000 |
| F | 8-10-19-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2916399090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
