4-tert-Butylbenzoyl chloride
- Product Name4-tert-Butylbenzoyl chloride
- CAS1710-98-1
- MFC11H13ClO
- MW196.67
- EINECS216-973-1
- MOL File1710-98-1.mol
Chemical Properties
| Melting point | 177.5-179 °C(Solv: ligroine (8032-32-4); dichloromethane (75-09-2)) |
| Boiling point | 135 °C20 mm Hg(lit.) |
| Density | 1.007 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 190 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| color | Clear colorless to very slightly yellow |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 775793 |
| InChI | 1S/C11H13ClO/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h4-7H,1-3H3 |
| InChIKey | WNLMYNASWOULQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)C(Cl)=O |
| CAS DataBase Reference | 1710-98-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 4-(1,1-dimethylethyl)-(1710-98-1) |
| EPA Substance Registry System | Benzoyl chloride, 4-(1,1-dimethylethyl)- (1710-98-1) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 9-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
