3-Cyanopropionaldehyde dimethyl acetal
- Product Name3-Cyanopropionaldehyde dimethyl acetal
- CAS14618-78-1
- MFC6H11NO2
- MW129.16
- EINECS238-658-8
- MOL File14618-78-1.mol
Chemical Properties
| Melting point | -119.1°C |
| Boiling point | 90-91 °C14 mm Hg(lit.) |
| Density | 0.992 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 193 °F |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Soluble in water |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H11NO2/c1-8-6(9-2)4-3-5-7/h6H,3-4H2,1-2H3 |
| InChIKey | XJHNCGVHPLDMRK-UHFFFAOYSA-N |
| SMILES | C(#N)CCC(OC)OC |
| CAS DataBase Reference | 14618-78-1(CAS DataBase Reference) |
| EPA Substance Registry System | Butanenitrile, 4,4-dimethoxy- (14618-78-1) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29269090 |