3-Bromopropionaldehyde dimethyl acetal
- Product Name3-Bromopropionaldehyde dimethyl acetal
- CAS36255-44-4
- MFC5H11BrO2
- MW183.04
- EINECS252-936-6
- MOL File36255-44-4.mol
Chemical Properties
| Boiling point | 58-60 °C17 mm Hg(lit.) |
| Density | 1.341 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 114 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Not miscible or difficult to mix with water. |
| BRN | 1697640 |
| InChI | InChI=1S/C5H11BrO2/c1-7-5(8-2)3-4-6/h5H,3-4H2,1-2H3 |
| InChIKey | ODZZAIFAQLODKN-UHFFFAOYSA-N |
| SMILES | C(OC)(OC)CCBr |
| CAS DataBase Reference | 36255-44-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29110000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
