Tetrabutylammonium triflate
- Product NameTetrabutylammonium triflate
- CAS35895-70-6
- MFC17H36F3NO3S
- MW391.53
- EINECS252-783-5
- MOL File35895-70-6.mol
Chemical Properties
| Melting point | 110-114 °C 112-113 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear, colorless |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 4172978 |
| InChI | 1S/C16H36N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YNJQKNVVBBIPBA-UHFFFAOYSA-M |
| SMILES | [O-]S(=O)(=O)C(F)(F)F.CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 35895-70-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Hygroscopic |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
