2-Hydroxyisonicotinic acid
- Product Name2-Hydroxyisonicotinic acid
- CAS22282-72-0
- MFC6H5NO3
- MW139.11
- EINECS947-323-1
- MOL File22282-72-0.mol
Chemical Properties
| Melting point | 300 |
| Boiling point | 384.0±42.0 °C(Predicted) |
| Density | 1.451±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| pka | 2+-.0.20(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H5NO3/c8-5-3-4(6(9)10)1-2-7-5/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | BXHCJLRTXPHUGH-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 22282-72-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
