4-Chlorophthalic acid monosodium salt
- Product Name4-Chlorophthalic acid monosodium salt
- CAS56047-23-5
- MFC8H6ClNaO4
- MW224.57
- EINECS259-963-2
- MOL File56047-23-5.mol
Chemical Properties
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| InChI | InChI=1S/C8H5ClO4.Na.H/c9-4-1-2-5(7(10)11)6(3-4)8(12)13;;/h1-3H,(H,10,11)(H,12,13);; |
| InChIKey | UWHMGHLCXCVELM-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(Cl)=CC=1C(=O)O)(=O)O.[NaH] |
| CAS DataBase Reference | 56047-23-5(CAS DataBase Reference) |
| EPA Substance Registry System | Monosodium 4-chlorophthalate (56047-23-5) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29173990 |
