2-Bromo-4-nitrophenol
- Product Name2-Bromo-4-nitrophenol
- CAS5847-59-6
- MFC6H4BrNO3
- MW218
- EINECS611-662-0
- MOL File5847-59-6.mol
Chemical Properties
| Melting point | 111-115 °C |
| Boiling point | 298.1±25.0 °C(Predicted) |
| Density | 1.8994 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.36±0.22(Predicted) |
| color | White to Yellow |
| Water Solubility | 22g/L(100 ºC) |
| λmax | 404nm(NaOH)(lit.) |
| BRN | 2441518 |
| InChI | 1S/C6H4BrNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H |
| InChIKey | DCIPFSYBGTWYCR-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1Br)[N+]([O-])=O |
| CAS DataBase Reference | 5847-59-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |