2,6-Dibromo-4-nitrophenol
- Product Name2,6-Dibromo-4-nitrophenol
- CAS99-28-5
- MFC6H3Br2NO3
- MW296.9
- EINECS202-744-3
- MOL File99-28-5.mol
Chemical Properties
| Melting point | 145 °C (dec.)(lit.) |
| Boiling point | 297.8±40.0 °C(Predicted) |
| Density | 2.3436 (rough estimate) |
| refractive index | 1.6220 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| pka | 3.67±0.44(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1245050 |
| InChI | InChI=1S/C6H3Br2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
| InChIKey | WBHYZUAQCSHXCT-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Br)C=C([N+]([O-])=O)C=C1Br |
| CAS DataBase Reference | 99-28-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Dibromo-4-nitrophenol(99-28-5) |
| EPA Substance Registry System | 2,6-Dibromo-4-nitrophenol (99-28-5) |
Safety Information
| Hazard Codes | Xn,C |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| RTECS | SK8025000 |
| TSCA | TSCA listed |
| HS Code | 29089990 |
