4'-Aminobiphenyl-4-carbonitrile
- Product Name4'-Aminobiphenyl-4-carbonitrile
- CAS4854-84-6
- MFC13H10N2
- MW194.23
- EINECS
- MOL File4854-84-6.mol
Chemical Properties
| Melting point | 182-186 °C(lit.) |
| Boiling point | 320.68°C (rough estimate) |
| Density | 1.1579 (rough estimate) |
| refractive index | 1.5014 (estimate) |
| storage temp. | 2-8°C, protect from light |
| Water Solubility | Insoluble in water |
| solubility | Chloroform, Methanol (Sparingly) |
| form | powder to crystal |
| pka | 3.78±0.10(Predicted) |
| color | White to Amber |
| InChI | 1S/C13H10N2/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8H,15H2 |
| InChIKey | CPJQKNUJNWPAPH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)-c2ccc(cc2)C#N |
| CAS DataBase Reference | 4854-84-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-41-50 |
| Safety Statements | 26-36/39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DV1763000 |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |
