Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride
- Product NameBicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride
- CAS1719-83-1
- MFC12H8O6
- MW248.19
- EINECS217-009-2
- MOL File1719-83-1.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| Boiling point | 351.26°C (rough estimate) |
| Density | 1.4501 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in water |
| Sensitive | Moisture Sensitive |
| BRN | 294213 |
| InChI | InChI=1S/C12H8O6/c13-9-5-3-1-2-4(7(5)11(15)17-9)8-6(3)10(14)18-12(8)16/h1-8H |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | O1C(=O)C2C3C=CC(C4C(=O)OC(=O)C43)C2C1=O |
| CAS DataBase Reference | 1719-83-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bicyclo[2.2.2]-7-octene-2,3,5,6-tetracarboxylic acid dianhydride(1719-83-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2917 20 00 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |