Melting point |
165-167 °C(lit.) |
Boiling point |
251.61°C (rough estimate) |
Density |
1.2132 (rough estimate) |
refractive index |
1.5260 (estimate) |
storage temp. |
Inert atmosphere,Room Temperature |
solubility |
diethyl ether: soluble0.1g/10 mL, clear, colorless |
form |
powder to crystal |
Specific Gravity |
1.250 (20/4℃) |
color |
White to Almost white |
Merck |
14,1796 |
BRN |
150228 |
InChI |
InChI=1S/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2 |
InChIKey |
KNDQHSIWLOJIGP-UHFFFAOYSA-N |
SMILES |
C1(=O)C2C(C3CC2C=C3)C(=O)O1 |
LogP |
-0.040 (est) |
CAS DataBase Reference |
826-62-0(CAS DataBase Reference) |
EPA Substance Registry System |
4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro- (826-62-0) |