1-Ethyl-3-methylimidazolium methanesulfonate
- Product Name1-Ethyl-3-methylimidazolium methanesulfonate
- CAS145022-45-3
- MFC7H14N2O3S
- MW206.26
- EINECS604-453-0
- MOL File145022-45-3.mol
Chemical Properties
| Melting point | 35°C |
| Density | 1.247 |
| Flash point | 67 °C |
| refractive index | 1.4970 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline |
| color | Light yellow to Brown |
| Water Solubility | Soluble in water. Soluble in acetone, methanol . |
| InChI | InChI=1S/C6H11N2.CH4O3S/c1-3-8-5-4-7(2)6-8;1-5(2,3)4/h4-6H,3H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | IXLWEDFOKSJYBD-UHFFFAOYSA-M |
| SMILES | S(C)(=O)(=O)[O-].[N+]1(C)C=CN(CC)C=1 |
| LogP | -3.2--3 at 23℃ and pH6 |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 22-34-52/53-43 |
| Safety Statements | 26-36/37/39-45-61-36/37 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 2 |
| F | 3-10 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Skin Sens. 1 |
