2,2-Dinaphthylamine
- Product Name2,2-Dinaphthylamine
- CAS532-18-3
- MFC20H15N
- MW269.34
- EINECS208-529-0
- MOL File532-18-3.mol
Chemical Properties
| Melting point | 174 °C |
| Boiling point | 471 °C |
| Density | 0.9788 (rough estimate) |
| refractive index | 1.7800 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very slightly in Ethanol |
| form | powder to crystal |
| color | White to Orange to Green |
| Merck | 14,3267 |
| InChI | InChI=1S/C20H15N/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14,21H |
| InChIKey | SBMXAWJSNIAHFR-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1NC1=CC=C2C(=C1)C=CC=C2 |
| NIST Chemistry Reference | 2-Naphthalenamine, N-2-naphthalenyl-(532-18-3) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2921.49.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |