(1S)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline
- Product Name(1S)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline
- CAS118864-75-8
- MFC15H15N
- MW209.29
- EINECS1806241-263-5
- MOL File118864-75-8.mol
Chemical Properties
| Melting point | 80-82°C |
| Boiling point | 338°C |
| Density | 1.065 |
| Flash point | 167°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.91±0.40(Predicted) |
| color | White to Off-White |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2/t15-/m0/s1 |
| InChIKey | PRTRSEDVLBBFJZ-HNNXBMFYSA-N |
| SMILES | [C@H]1(C2=CC=CC=C2)C2=C(C=CC=C2)CCN1 |
| CAS DataBase Reference | 118864-75-8(CAS DataBase Reference) |
