Chemical Properties
| Melting point | 300 °C |
| Boiling point | 648.45°C (rough estimate) |
| Density | 1.5288 (rough estimate) |
| refractive index | 1.7030 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | dichloromethane: soluble |
| form | Glistening Crystalline Powder |
| color | Blue to purple |
| Appearance | Orange to Brown to Dark purple powder to crystal |
| Water Solubility | Insoluble in water. |
| λmax | 514 nm |
| ε(extinction coefficient) | ≥3500 at 480-486nm in toluene ≥4000 at 647-653nm in toluene ≥5000 at 589-595 nm in toluene ≥8000 at 546-552nm in toluene |
| BRN | 379542 |
| Stability | Light Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | YNHJECZULSZAQK-LWQDQPMZSA-N |
| SMILES | c1ccc(cc1)-c2c3ccc(n3)c(-c4ccccc4)c5ccc([nH]5)c(-c6ccccc6)c7ccc(n7)c(-c8ccccc8)c9ccc2[nH]9 |
| EPA Substance Registry System | 21H,23H-Porphine, 5,10,15,20-tetraphenyl- (917-23-7) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
