| Melting point |
115-118 °C(lit.) |
| Boiling point |
434.27°C (rough estimate) |
| Density |
1.1925 (rough estimate) |
| refractive index |
1.5700 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
very faint turbidity in Acetonitrile |
| form |
powder to crystal |
| pka |
5.06±0.10(Predicted) |
| color |
White to Brown |
| InChI |
InChI=1S/C18H16N2O2/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16/h1-12H,19-20H2 |
| InChIKey |
WUPRYUDHUFLKFL-UHFFFAOYSA-N |
| SMILES |
C1(OC2=CC=C(N)C=C2)=CC=CC(OC2=CC=C(N)C=C2)=C1 |
| CAS DataBase Reference |
2479-46-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenamine, 4,4'-[1,3-phenylenebis(oxy)]bis- (2479-46-1) |
