Cyclophosphamide monohydrate
- Product NameCyclophosphamide monohydrate
- CAS6055-19-2
- MFC7H17Cl2N2O3P
- MW279.1
- EINECS200-015-4
- MOL File6055-19-2.mol
Chemical Properties
| Melting point | 49-51 °C (lit.) |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| color | White to almost white |
| Water Solubility | 40 g/L |
| Merck | 14,2747 |
| BRN | 8167897 |
| Stability | Hygroscopic |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C7H15Cl2N2O2P.H2O/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14;/h1-7H2,(H,10,12);1H2 |
| InChIKey | PWOQRKCAHTVFLB-UHFFFAOYSA-N |
| SMILES | P1(=O)(OCCCN1)N(CCCl)CCCl.O |
| CAS DataBase Reference | 6055-19-2(CAS DataBase Reference) |
| IARC | 1 (Vol. 26, Sup 7, 100A) 2012 |
| EPA Substance Registry System | Cyclophosphamide monohydrate (6055-19-2) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-25-61-46-36/37/38-23/24/25 |
| Safety Statements | 53-45-37/39-26 |
| RIDADR | UN 3464 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RP6157750 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 1B Muta. 1B Repr. 1A |
