4-Chloro-3-fluoroaniline
- Product Name4-Chloro-3-fluoroaniline
- CAS367-22-6
- MFC6H5ClFN
- MW145.56
- EINECS206-683-3
- MOL File367-22-6.mol
Chemical Properties
| Melting point | 61 |
| Boiling point | 226°C(lit.) |
| Density | 1.349±0.06 g/cm3(Predicted) |
| Flash point | 60 - 62°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.94±0.10(Predicted) |
| color | White to Gray to Red |
| BRN | 2716278 |
| InChI | InChI=1S/C6H5ClFN/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2 |
| InChIKey | ACMJJQYSPUPMPN-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C(F)=C1 |
| CAS DataBase Reference | 367-22-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-63-45-38 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |