Trimethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]silane
- Product NameTrimethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]silane
- CAS3388-04-3
- MFC11H22O4Si
- MW246.38
- EINECS222-217-1
- MOL File3388-04-3.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 310 °C(lit.) |
| Density | 1.065 g/mL at 25 °C(lit.) |
| vapor pressure | 0.46Pa at 25℃ |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | liquid |
| Specific Gravity | 1.065 |
| color | Colorless to Almost colorless |
| Water Solubility | 1.4g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8980119 |
| InChI | 1S/C11H22O4Si/c1-12-16(13-2,14-3)7-6-9-4-5-10-11(8-9)15-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | DQZNLOXENNXVAD-UHFFFAOYSA-N |
| SMILES | CO[Si](CCC1CCC2OC2C1)(OC)OC |
| LogP | 2.5 at 20℃ |
| CAS DataBase Reference | 3388-04-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-46-45/46 |
| Safety Statements | 53-23-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | VV4000000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Carc. 2 Muta. 2 Skin Sens. 1B |
| Toxicity | LD50 oral in rat: 8mL/kg |
