2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane
- Product Name2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane
- CAS10217-34-2
- MFC14H28O4Si
- MW288.46
- EINECS425-050-4
- MOL File10217-34-2.mol
Chemical Properties
| Boiling point | 114-117°C 0,4mm |
| Density | 1,015 g/cm3 |
| vapor pressure | 0.3Pa at 20℃ |
| refractive index | 1.4455 |
| Flash point | 104°C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.015 |
| Water Solubility | 850mg/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Henry's Law Constant | 9.9×100 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| InChI | InChI=1S/C14H28O4Si/c1-4-15-19(16-5-2,17-6-3)10-9-12-7-8-13-14(11-12)18-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | UDUKMRHNZZLJRB-UHFFFAOYSA-N |
| SMILES | C12C(O1)CCC(CC[Si](OCC)(OCC)OCC)C2 |
| LogP | 4.6 at 23℃ |
| CAS DataBase Reference | 10217-34-2 |
| EPA Substance Registry System | Silane, triethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]- (10217-34-2) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-28-36/37/39 |
| WGK Germany | WGK 1 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Skin Sens. 1 |
