3-(4-Chlorobenzoyl)propionic acid
- Product Name3-(4-Chlorobenzoyl)propionic acid
- CAS3984-34-7
- MFC10H9ClO3
- MW212.63
- EINECS223-627-3
- MOL File3984-34-7.mol
Chemical Properties
| Melting point | 128-130 °C (lit.) |
| Boiling point | 305.28°C (rough estimate) |
| Density | 1.2781 (rough estimate) |
| refractive index | 1.5470 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: insoluble(lit.) |
| pka | 4.44±0.17(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Insoluble |
| BRN | 2104409 |
| InChI | InChI=1S/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14) |
| InChIKey | AHVASTJJVAYFPY-UHFFFAOYSA-N |
| SMILES | C1(C=CC(Cl)=CC=1)C(=O)CCC(=O)O |
| CAS DataBase Reference | 3984-34-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
