| Melting point |
79-82 °C (lit.) |
| Boiling point |
126 °C / 6mmHg |
| Density |
1.2021 (rough estimate) |
| refractive index |
1.5300 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
Crystalline Needles or Powder |
| pka |
0.88±0.10(Predicted) |
| color |
White to off-white |
| Water Solubility |
Soluble in water, chloroform, and DMSO. |
| BRN |
118286 |
| InChI |
InChI=1S/C9H9NO2/c1-6(11)8-4-3-5-9(10-8)7(2)12/h3-5H,1-2H3 |
| InChIKey |
BEZVGIHGZPLGBL-UHFFFAOYSA-N |
| SMILES |
C1(C(=O)C)=NC(C(=O)C)=CC=C1 |
| LogP |
1.319 (est) |
| CAS DataBase Reference |
1129-30-2(CAS DataBase Reference) |
