1,4-Bis(2-methylstyryl)benzene
- Product Name1,4-Bis(2-methylstyryl)benzene
- CAS13280-61-0
- MFC24H22
- MW310.43
- EINECS236-285-5
- MOL File13280-61-0.mol
Chemical Properties
| Melting point | 180-182 °C(lit.) |
| Boiling point | 385.59°C (rough estimate) |
| Density | 1.0591 (estimate) |
| refractive index | 1.9130 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | dioxane: 0.5 g/10 mL at hot, clear to hazy, colorless to light yellow |
| form | Crystalline Powder |
| color | Light green to yellow-green |
| Sensitive | Light Sensitive |
| BRN | 2375845 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C24H22/c1-19-7-3-5-9-23(19)17-15-21-11-13-22(14-12-21)16-18-24-10-6-4-8-20(24)2/h3-18H,1-2H3 |
| InChIKey | QKLPIYTUUFFRLV-UHFFFAOYSA-N |
| SMILES | C1(C=CC2=CC=CC=C2C)=CC=C(C=CC2=CC=CC=C2C)C=C1 |
| CAS DataBase Reference | 13280-61-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,4-bis[2-(2-methylphenyl)ethenyl]- (13280-61-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 2902900000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |