Tetramethylammonium triacetoxyborohydride
- Product NameTetramethylammonium triacetoxyborohydride
- CAS109704-53-2
- MFC10H22BNO6
- MW263.1
- EINECS
- MOL File109704-53-2.mol
Chemical Properties
| Melting point | 93-98 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | slightly sol. in dichloromethane |
| form | powder to crystal |
| color | White to Almost white |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8238791 |
| InChI | 1S/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
| InChIKey | LCFZZOGKVOTFPU-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.CC(=O)O[BH-](OC(C)=O)OC(C)=O |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 15-36/37/38 |
| Safety Statements | 26-36-43 |
| RIDADR | UN 2813 4.3/PG 2 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Water-react 2 |