Tetramethylammonium triacetoxyborohydride
- Product NameTetramethylammonium triacetoxyborohydride
- CAS109704-53-2
- CBNumberCB4758532
- MFC10H22BNO6
- MW263.1
- MDL NumberMFCD00012196
- MOL File109704-53-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 93-98 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | slightly sol. in dichloromethane |
| form | powder to crystal |
| color | White to Almost white |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8238791 |
| InChI | 1S/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
| InChIKey | LCFZZOGKVOTFPU-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.CC(=O)O[BH-](OC(C)=O)OC(C)=O |
| UNSPSC Code | 12352116 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H261-H315-H319-H335 | |||||||||
| Precautionary statements | P223-P231+P232-P261-P264-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 15-36/37/38 | |||||||||
| Safety Statements | 26-36-43 | |||||||||
| RIDADR | UN 2813 4.3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10-21 | |||||||||
| HazardClass | 4.3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29239000 | |||||||||
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Water-react 2 | |||||||||
| NFPA 704: |
|
