3',5'-Dibromo-4'-hydroxyacetophenone
- Product Name3',5'-Dibromo-4'-hydroxyacetophenone
- CAS2887-72-1
- MFC8H6Br2O2
- MW293.94
- EINECS220-750-4
- MOL File2887-72-1.mol
Chemical Properties
| Melting point | 182-187 °C(lit.) |
| Boiling point | 337.7±42.0 °C(Predicted) |
| Density | 1.936±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | very faint turbidity in hot Methanol |
| form | powder to crystal |
| pka | 5.11±0.23(Predicted) |
| color | White to Almost white |
| InChI | 1S/C8H6Br2O2/c1-4(11)5-2-6(9)8(12)7(10)3-5/h2-3,12H,1H3 |
| InChIKey | ZNWPTJSBHHIXLJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Br)c(O)c(Br)c1 |
| CAS DataBase Reference | 2887-72-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2914790090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |