5-Chloro-2-methylphenol
- Product Name5-Chloro-2-methylphenol
- CAS5306-98-9
- MFC7H7ClO
- MW142.58
- EINECS226-160-3
- MOL File5306-98-9.mol
Chemical Properties
| Melting point | 72-76 °C (lit.) |
| Boiling point | 109-112°C 15mm |
| Density | 1.1104 (rough estimate) |
| refractive index | 1.4443 (estimate) |
| Flash point | 109-112°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 9.35±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1906683 |
| InChI | InChI=1S/C7H7ClO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3 |
| InChIKey | KKFPXGXMSBBNJI-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Cl)=CC=C1C |
| CAS DataBase Reference | 5306-98-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 5-chloro-2-methyl-(5306-98-9) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-38-21/22 |
| Safety Statements | 26-36-28 |
| RIDADR | UN 3437 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29081990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
